About 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione
3,9-difluoroindazolo[2,1-a]indazole-6,12-dione (PubChem CID 102073987) has the molecular formula C14H6F2N2O2
and a molecular weight of 272.21 g/mol. Its IUPAC name is 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione.
Molecular Properties
| Compound Name | 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione |
| PubChem CID | 102073987 |
| Molecular Formula | C14H6F2N2O2 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione |
| SMILES | O=c1c2ccc(F)cc2n2c(=O)c3ccc(F)cc3n12 |
| InChI | InChI=1S/C14H6F2N2O2/c15-7-1-3-9-11(5-7)17-14(20)10-4-2-8(16)6-12(10)18(17)13(9)19/h1-6H |
| InChIKey | WBXULPPQQBZXAU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione?
The IUPAC name of 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione (CID 102073987) is 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione.
What is the SMILES notation for 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione?
The canonical SMILES for 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione is O=c1c2ccc(F)cc2n2c(=O)c3ccc(F)cc3n12.
What is the InChIKey of 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione?
The InChIKey is WBXULPPQQBZXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6F2N2O2/c15-7-1-3-9-11(5-7)17-14(20)10-4-2-8(16)6-12(10)18(17)13(9)19/h1-6H.
What are the key properties of 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione?
3,9-difluoroindazolo[2,1-a]indazole-6,12-dione has a molecular weight of 272.21 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-difluoroindazolo[2,1-a]indazole-6,12-dione is sourced from PubChem (CID 102073987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).