About 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one
7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 102074346) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one.
Molecular Properties
| Compound Name | 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| PubChem CID | 102074346 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | COC1=CC2(C=C(OC)C1=O)CCCO2 |
| InChI | InChI=1S/C11H14O4/c1-13-8-6-11(4-3-5-15-11)7-9(14-2)10(8)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | MAKBXNYRXXDXCU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one (CID 102074346) is 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one is COC1=CC2(C=C(OC)C1=O)CCCO2.
What is the InChIKey of 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is MAKBXNYRXXDXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-13-8-6-11(4-3-5-15-11)7-9(14-2)10(8)12/h6-7H,3-5H2,1-2H3.
What are the key properties of 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one?
7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 210.23 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dimethoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 102074346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).