C51H33F9O6S3 — CID 102074377
1,3,5-tris[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]benzene (PubChem CID 102074377) has the molecular formula C51H33F9O6S3 and a molecular weight of 1009.00 g/mol. Its IUPAC name is 1,3,5-tris[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]benzene.
| Compound Name | 1,3,5-tris[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]benzene |
|---|---|
| PubChem CID | 102074377 |
| Molecular Formula | C51H33F9O6S3 |
| Molecular Weight | 1009.00 g/mol |
| Exact Mass | 1008.13 |
| IUPAC Name | 1,3,5-tris[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]benzene |
| SMILES | O=S(=O)(c1ccc(/C=C/c2ccc(-c3cc(-c4ccc(/C=C/c5ccc(S(=O)(=O)C(F)(F)F)cc5)cc4)cc(-c4ccc(/C=C/c5ccc(S(=O)(=O)C(F)(F)F)cc5)cc4)c3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C51H33F9O6S3/c52-49(53,54)67(61,62)46-25-13-37(14-26-46)4-1-34-7-19-40(20-8-34)43-31-44(41-21-9-35(10-22-41)2-5-38-15-27-47(28-16-38)68(63,64)50(55,56)57)33-45(32-43)42-23-11-36(12-24-42)3-6-39-17-29-48(30-18-39)69(65,66)51(58,59)60/h1-33H/b4-1+,5-2+,6-3+ |
| InChIKey | OXPDPYNXHBASNB-GZDDRBCLSA-N |
| XLogP | 14.08 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.00 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|