C42H40F16P2 — CID 102074564
[14-bis(2-methylphenyl)phosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl]-bis(2-methylphenyl)phosphane (PubChem CID 102074564) has the molecular formula C42H40F16P2 and a molecular weight of 910.70 g/mol. Its IUPAC name is [14-bis(2-methylphenyl)phosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl]-bis(2-methylphenyl)phosphane.
| Compound Name | [14-bis(2-methylphenyl)phosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl]-bis(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 102074564 |
| Molecular Formula | C42H40F16P2 |
| Molecular Weight | 910.70 g/mol |
| Exact Mass | 910.23 |
| IUPAC Name | [14-bis(2-methylphenyl)phosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl]-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCP(c1ccccc1C)c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C42H40F16P2/c1-27-15-5-9-19-31(27)59(32-20-10-6-16-28(32)2)25-13-23-35(43,44)37(47,48)39(51,52)41(55,56)42(57,58)40(53,54)38(49,50)36(45,46)24-14-26-60(33-21-11-7-17-29(33)3)34-22-12-8-18-30(34)4/h5-12,15-22H,13-14,23-26H2,1-4H3 |
| InChIKey | IXHCHARDWUEYMT-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.70 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|