C22H18N2O7 — CID 102074625
dimethyl (3R,4aS)-3-(3-nitrophenyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-1,2-dicarboxylate (PubChem CID 102074625) has the molecular formula C22H18N2O7 and a molecular weight of 422.39 g/mol. Its IUPAC name is dimethyl (3R,4aS)-3-(3-nitrophenyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-1,2-dicarboxylate.
| Compound Name | dimethyl (3R,4aS)-3-(3-nitrophenyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102074625 |
| Molecular Formula | C22H18N2O7 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | dimethyl (3R,4aS)-3-(3-nitrophenyl)-3,4a-dihydro-[1,3]oxazino[3,2-a]quinoline-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2c3ccccc3C=C[C@@H]2O[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N2O7/c1-29-21(25)18-19(22(26)30-2)23-16-9-4-3-6-13(16)10-11-17(23)31-20(18)14-7-5-8-15(12-14)24(27)28/h3-12,17,20H,1-2H3/t17-,20+/m0/s1 |
| InChIKey | FINDVZZTTFNHCX-FXAWDEMLSA-N |
| XLogP | 3.13 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|