About CID 102075869
CID 102075869 (PubChem CID 102075869) has the molecular formula C24H16Cl4N4O4P4
and a molecular weight of 690.12 g/mol.
Molecular Properties
| Compound Name | CID 102075869 |
| PubChem CID | 102075869 |
| Molecular Formula | C24H16Cl4N4O4P4 |
| Molecular Weight | 690.12 g/mol |
| Exact Mass | 687.89 |
| IUPAC Name | — |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP2(=NP3(=N1)Oc1ccccc1-c1ccccc1O3)Oc1ccccc1-c1ccccc1O2 |
| InChI | InChI=1S/C24H16Cl4N4O4P4/c25-37(26)29-38(27,28)31-40(35-23-15-7-3-11-19(23)20-12-4-8-16-24(20)36-40)32-39(30-37)33-21-13-5-1-9-17(21)18-10-2-6-14-22(18)34-39/h1-16H |
| InChIKey | GYPNNKNDGSDSAU-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 690.12 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102075869 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102075869?
The IUPAC name of CID 102075869 (CID 102075869) is not available.
What is the SMILES notation for CID 102075869?
The canonical SMILES for CID 102075869 is ClP1(Cl)=NP(Cl)(Cl)=NP2(=NP3(=N1)Oc1ccccc1-c1ccccc1O3)Oc1ccccc1-c1ccccc1O2.
What is the InChIKey of CID 102075869?
The InChIKey is GYPNNKNDGSDSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16Cl4N4O4P4/c25-37(26)29-38(27,28)31-40(35-23-15-7-3-11-19(23)20-12-4-8-16-24(20)36-40)32-39(30-37)33-21-13-5-1-9-17(21)18-10-2-6-14-22(18)34-39/h1-16H.
What are the key properties of CID 102075869?
CID 102075869 has a molecular weight of 690.12 g/mol, XLogP of 13.02, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102075869 is sourced from PubChem (CID 102075869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).