C31H29N3O4 — CID 10207589
N-[(3,4-dimethoxyphenyl)methyl]-10-(4-methoxyphenyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide (PubChem CID 10207589) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-10-(4-methoxyphenyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-10-(4-methoxyphenyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 10207589 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-10-(4-methoxyphenyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3Cc3c(C(=O)NCc4ccc(OC)c(OC)c4)ccn32)cc1 |
| InChI | InChI=1S/C31H29N3O4/c1-36-21-11-9-20(10-12-21)30-29-24(22-6-4-5-7-25(22)33-29)17-26-23(14-15-34(26)30)31(35)32-18-19-8-13-27(37-2)28(16-19)38-3/h4-16,30,33H,17-18H2,1-3H3,(H,32,35) |
| InChIKey | ZJLYAGZRHCLJEN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|