C28H34O4 — CID 102076234
(2Z)-5,22-dihydroxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(23),2,4(24),5,7,19,21-heptaene-6,21-dicarbaldehyde (PubChem CID 102076234) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (2Z)-5,22-dihydroxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(23),2,4(24),5,7,19,21-heptaene-6,21-dicarbaldehyde.
| Compound Name | (2Z)-5,22-dihydroxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(23),2,4(24),5,7,19,21-heptaene-6,21-dicarbaldehyde |
|---|---|
| PubChem CID | 102076234 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (2Z)-5,22-dihydroxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(23),2,4(24),5,7,19,21-heptaene-6,21-dicarbaldehyde |
| SMILES | C/C1=C(\C)c2cc(cc(C=O)c2O)CCCCCCCCCCc2cc(C=O)c(O)c1c2 |
| InChI | InChI=1S/C28H34O4/c1-19-20(2)26-16-22(14-24(18-30)28(26)32)12-10-8-6-4-3-5-7-9-11-21-13-23(17-29)27(31)25(19)15-21/h13-18,31-32H,3-12H2,1-2H3/b20-19- |
| InChIKey | NAUAXHHAKRYNLC-VXPUYCOJSA-N |
| XLogP | 6.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|