C17H10F6O4S2 — CID 102076934
4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid (PubChem CID 102076934) has the molecular formula C17H10F6O4S2 and a molecular weight of 456.39 g/mol. Its IUPAC name is 4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102076934 |
| Molecular Formula | C17H10F6O4S2 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1C1=C(c2cc(C(=O)O)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H10F6O4S2/c1-5-7(3-9(28-5)13(24)25)11-12(8-4-10(14(26)27)29-6(8)2)16(20,21)17(22,23)15(11,18)19/h3-4H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | IMOLFLXWIUQUFC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|