C10H5N3O3 — CID 102077190
7-nitropyrazolo[1,5-b]isoindol-5-one (PubChem CID 102077190) has the molecular formula C10H5N3O3 and a molecular weight of 215.17 g/mol. Its IUPAC name is 7-nitropyrazolo[1,5-b]isoindol-5-one.
| Compound Name | 7-nitropyrazolo[1,5-b]isoindol-5-one |
|---|---|
| PubChem CID | 102077190 |
| Molecular Formula | C10H5N3O3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 7-nitropyrazolo[1,5-b]isoindol-5-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2ccnn21 |
| InChI | InChI=1S/C10H5N3O3/c14-10-8-5-6(13(15)16)1-2-7(8)9-3-4-11-12(9)10/h1-5H |
| InChIKey | BWMUPLBAXNFMIX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|