About 6,8-dihydrofuro[3,4-g]quinoline
6,8-dihydrofuro[3,4-g]quinoline (PubChem CID 102077867) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6,8-dihydrofuro[3,4-g]quinoline.
Molecular Properties
| Compound Name | 6,8-dihydrofuro[3,4-g]quinoline |
| PubChem CID | 102077867 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 6,8-dihydrofuro[3,4-g]quinoline |
| SMILES | c1cnc2cc3c(cc2c1)COC3 |
| InChI | InChI=1S/C11H9NO/c1-2-8-4-9-6-13-7-10(9)5-11(8)12-3-1/h1-5H,6-7H2 |
| InChIKey | XOWLCHIGJCOJQJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dihydrofuro[3,4-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydrofuro[3,4-g]quinoline?
The IUPAC name of 6,8-dihydrofuro[3,4-g]quinoline (CID 102077867) is 6,8-dihydrofuro[3,4-g]quinoline.
What is the SMILES notation for 6,8-dihydrofuro[3,4-g]quinoline?
The canonical SMILES for 6,8-dihydrofuro[3,4-g]quinoline is c1cnc2cc3c(cc2c1)COC3.
What is the InChIKey of 6,8-dihydrofuro[3,4-g]quinoline?
The InChIKey is XOWLCHIGJCOJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-8-4-9-6-13-7-10(9)5-11(8)12-3-1/h1-5H,6-7H2.
What are the key properties of 6,8-dihydrofuro[3,4-g]quinoline?
6,8-dihydrofuro[3,4-g]quinoline has a molecular weight of 171.20 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydrofuro[3,4-g]quinoline is sourced from PubChem (CID 102077867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).