About 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one
9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one (PubChem CID 102077888) has the molecular formula C18H16N2O2S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one.
Molecular Properties
| Compound Name | 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one |
| PubChem CID | 102077888 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one |
| SMILES | COc1ccc(-c2cc3nc4c(c(N)c3s2)C(=O)CCC4)cc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-22-11-7-5-10(6-8-11)15-9-13-18(23-15)17(19)16-12(20-13)3-2-4-14(16)21/h5-9H,2-4H2,1H3,(H2,19,20) |
| InChIKey | RYFKOAWRSDBRMD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one?
The IUPAC name of 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one (CID 102077888) is 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one.
What is the SMILES notation for 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one?
The canonical SMILES for 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one is COc1ccc(-c2cc3nc4c(c(N)c3s2)C(=O)CCC4)cc1.
What is the InChIKey of 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one?
The InChIKey is RYFKOAWRSDBRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2S/c1-22-11-7-5-10(6-8-11)15-9-13-18(23-15)17(19)16-12(20-13)3-2-4-14(16)21/h5-9H,2-4H2,1H3,(H2,19,20).
What are the key properties of 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one?
9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one has a molecular weight of 324.41 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-2-(4-methoxyphenyl)-6,7-dihydro-5H-thieno[3,2-b]quinolin-8-one is sourced from PubChem (CID 102077888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).