C28H36N2O7 — CID 10207819
[(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-(4-tert-butylphenyl)carbamate (PubChem CID 10207819) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-(4-tert-butylphenyl)carbamate.
| Compound Name | [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-(4-tert-butylphenyl)carbamate |
|---|---|
| PubChem CID | 10207819 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-(4-tert-butylphenyl)carbamate |
| SMILES | CC1C(=O)O[C@H]2C[C@]3(C)O[C@H]3[C@H](OC(=O)Nc3ccc(C(C)(C)C)cc3)[C@@H](N(C)C)C3=C[C@@H](OC3=O)[C@H]12 |
| InChI | InChI=1S/C28H36N2O7/c1-14-20-18-12-17(25(32)34-18)21(30(6)7)22(23-28(5,37-23)13-19(20)35-24(14)31)36-26(33)29-16-10-8-15(9-11-16)27(2,3)4/h8-12,14,18-23H,13H2,1-7H3,(H,29,33)/t14?,18-,19+,20+,21+,22-,23+,28+/m1/s1 |
| InChIKey | MROVEARPZMDQDD-JOFOJXMGSA-N |
| XLogP | 3.42 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|