C30H43NO4S — CID 10207878
[2,6-di(propan-2-yl)phenyl] N-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-2-enoyl]sulfamate (PubChem CID 10207878) has the molecular formula C30H43NO4S and a molecular weight of 513.74 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] N-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-2-enoyl]sulfamate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] N-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-2-enoyl]sulfamate |
|---|---|
| PubChem CID | 10207878 |
| Molecular Formula | C30H43NO4S |
| Molecular Weight | 513.74 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] N-[(E)-3-[2,4,6-tri(propan-2-yl)phenyl]prop-2-enoyl]sulfamate |
| SMILES | CC(C)c1cc(C(C)C)c(/C=C/C(=O)NS(=O)(=O)Oc2c(C(C)C)cccc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C30H43NO4S/c1-18(2)23-16-27(21(7)8)26(28(17-23)22(9)10)14-15-29(32)31-36(33,34)35-30-24(19(3)4)12-11-13-25(30)20(5)6/h11-22H,1-10H3,(H,31,32)/b15-14+ |
| InChIKey | RYPKPXNSXSBSMY-CCEZHUSRSA-N |
| XLogP | 7.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.74 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|