C12H19NO5 — CID 102079197
1-[(1R,2R,6R,7R)-1-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[5.3.1.02,6]undecan-9-yl]ethanone (PubChem CID 102079197) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[(1R,2R,6R,7R)-1-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[5.3.1.02,6]undecan-9-yl]ethanone.
| Compound Name | 1-[(1R,2R,6R,7R)-1-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[5.3.1.02,6]undecan-9-yl]ethanone |
|---|---|
| PubChem CID | 102079197 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-[(1R,2R,6R,7R)-1-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[5.3.1.02,6]undecan-9-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2O[C@@](CO)(C1)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H19NO5/c1-7(15)13-4-8-9-10(18-11(2,3)17-9)12(5-13,6-14)16-8/h8-10,14H,4-6H2,1-3H3/t8-,9-,10-,12-/m1/s1 |
| InChIKey | IXSRXPCDHXVRJH-DNRKLUKYSA-N |
| XLogP | -0.50 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |