C23H26F3NO — CID 102079282
3-phenyl-3-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-2-benzofuran-1-imine (PubChem CID 102079282) has the molecular formula C23H26F3NO and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-phenyl-3-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-2-benzofuran-1-imine.
| Compound Name | 3-phenyl-3-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-2-benzofuran-1-imine |
|---|---|
| PubChem CID | 102079282 |
| Molecular Formula | C23H26F3NO |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 3-phenyl-3-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-2-benzofuran-1-imine |
| SMILES | CC(C)(C)CC(C)(C)/N=C1\OC(c2ccccc2)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C23H26F3NO/c1-20(2,3)15-21(4,5)27-19-17-13-9-10-14-18(17)22(28-19,23(24,25)26)16-11-7-6-8-12-16/h6-14H,15H2,1-5H3/b27-19- |
| InChIKey | CNFQJNQLVHBRHM-DIBXZPPDSA-N |
| XLogP | 6.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|