About (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one
(3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one (PubChem CID 102079564) has the molecular formula C20H40O4Si2
and a molecular weight of 400.71 g/mol. Its IUPAC name is (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one.
Molecular Properties
| Compound Name | (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one |
| PubChem CID | 102079564 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C/C=C1\CCOC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-19(2,3)25(7,8)23-15-17(24-26(9,10)20(4,5)6)12-11-16-13-14-22-18(16)21/h11,17H,12-15H2,1-10H3/b16-11+ |
| InChIKey | DHMAZFUXSMVCJF-LFIBNONCSA-N |
| XLogP | 5.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one?
The IUPAC name of (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one (CID 102079564) is (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one.
What is the SMILES notation for (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one?
The canonical SMILES for (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one is CC(C)(C)[Si](C)(C)OCC(C/C=C1\CCOC1=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one?
The InChIKey is DHMAZFUXSMVCJF-LFIBNONCSA-N. The full InChI is InChI=1S/C20H40O4Si2/c1-19(2,3)25(7,8)23-15-17(24-26(9,10)20(4,5)6)12-11-16-13-14-22-18(16)21/h11,17H,12-15H2,1-10H3/b16-11+.
What are the key properties of (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one?
(3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one has a molecular weight of 400.71 g/mol, XLogP of 5.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butylidene]oxolan-2-one is sourced from PubChem (CID 102079564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).