About 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol
3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol (PubChem CID 102080181) has the molecular formula C17H16O5
and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol.
Molecular Properties
| Compound Name | 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol |
| PubChem CID | 102080181 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol |
| SMILES | COc1cc(C2=Cc3ccc(O)cc3OC2)cc(O)c1OC |
| InChI | InChI=1S/C17H16O5/c1-20-16-7-11(6-14(19)17(16)21-2)12-5-10-3-4-13(18)8-15(10)22-9-12/h3-8,18-19H,9H2,1-2H3 |
| InChIKey | MVOKTSMMZKRCIQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol?
The IUPAC name of 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol (CID 102080181) is 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol.
What is the SMILES notation for 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol?
The canonical SMILES for 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol is COc1cc(C2=Cc3ccc(O)cc3OC2)cc(O)c1OC.
What is the InChIKey of 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol?
The InChIKey is MVOKTSMMZKRCIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O5/c1-20-16-7-11(6-14(19)17(16)21-2)12-5-10-3-4-13(18)8-15(10)22-9-12/h3-8,18-19H,9H2,1-2H3.
What are the key properties of 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol?
3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol has a molecular weight of 300.31 g/mol, XLogP of 3.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxy-4,5-dimethoxyphenyl)-2H-chromen-7-ol is sourced from PubChem (CID 102080181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).