C27H27NO2 — CID 102080261
tert-butyl (2S)-2,4,5-triphenyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 102080261) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl (2S)-2,4,5-triphenyl-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2,4,5-triphenyl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 102080261 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl (2S)-2,4,5-triphenyl-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccccc2)=C(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H27NO2/c1-27(2,3)30-26(29)28-24(21-15-9-5-10-16-21)19-23(20-13-7-4-8-14-20)25(28)22-17-11-6-12-18-22/h4-18,24H,19H2,1-3H3/t24-/m0/s1 |
| InChIKey | BCNWEFMYTNUTOJ-DEOSSOPVSA-N |
| XLogP | 6.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|