C16H12F3NO3 — CID 102080375
methyl 3-oxo-1-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrolizine-2-carboxylate (PubChem CID 102080375) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is methyl 3-oxo-1-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrolizine-2-carboxylate.
| Compound Name | methyl 3-oxo-1-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 102080375 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | methyl 3-oxo-1-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrolizine-2-carboxylate |
| SMILES | COC(=O)C1C(=O)n2cccc2C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3NO3/c1-23-15(22)13-12(11-3-2-8-20(11)14(13)21)9-4-6-10(7-5-9)16(17,18)19/h2-8,12-13H,1H3 |
| InChIKey | SADGDXKYNFHSRP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|