C29H39NO6Si — CID 102080594
methyl (2S,3R,3aS,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate (PubChem CID 102080594) has the molecular formula C29H39NO6Si and a molecular weight of 525.72 g/mol. Its IUPAC name is methyl (2S,3R,3aS,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate.
| Compound Name | methyl (2S,3R,3aS,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 102080594 |
| Molecular Formula | C29H39NO6Si |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | methyl (2S,3R,3aS,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
| SMILES | COC(=O)CC[C@@H]1ON2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@H]2[C@H]1C(=O)OC |
| InChI | InChI=1S/C29H39NO6Si/c1-29(2,3)37(22-12-8-6-9-13-22,23-14-10-7-11-15-23)35-20-21-16-17-24-27(28(32)34-5)25(36-30(21)24)18-19-26(31)33-4/h6-15,21,24-25,27H,16-20H2,1-5H3/t21-,24-,25-,27+/m0/s1 |
| InChIKey | JDIGRNUBWLCPMI-GRAQQIFLSA-N |
| XLogP | 3.45 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|