C15H17NO5S — CID 102081192
ethyl 2-[(3S,4R,5S)-4-formyl-5-(4-nitrophenyl)thiolan-3-yl]acetate (PubChem CID 102081192) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is ethyl 2-[(3S,4R,5S)-4-formyl-5-(4-nitrophenyl)thiolan-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4R,5S)-4-formyl-5-(4-nitrophenyl)thiolan-3-yl]acetate |
|---|---|
| PubChem CID | 102081192 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | ethyl 2-[(3S,4R,5S)-4-formyl-5-(4-nitrophenyl)thiolan-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CS[C@H](c2ccc([N+](=O)[O-])cc2)[C@H]1C=O |
| InChI | InChI=1S/C15H17NO5S/c1-2-21-14(18)7-11-9-22-15(13(11)8-17)10-3-5-12(6-4-10)16(19)20/h3-6,8,11,13,15H,2,7,9H2,1H3/t11-,13+,15-/m1/s1 |
| InChIKey | YSDYCVWUIYENPJ-OSAQELSMSA-N |
| XLogP | 2.77 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|