C19H21BF2N4 — CID 102081742
4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzene-1,2-diamine (PubChem CID 102081742) has the molecular formula C19H21BF2N4 and a molecular weight of 354.21 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzene-1,2-diamine.
| Compound Name | 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 102081742 |
| Molecular Formula | C19H21BF2N4 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzene-1,2-diamine |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(N)c(N)c1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C19H21BF2N4/c1-10-7-12(3)25-18(10)17(14-5-6-15(23)16(24)9-14)19-11(2)8-13(4)26(19)20(25,21)22/h5-9H,23-24H2,1-4H3 |
| InChIKey | AKGSPIHPDODTGG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|