About tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate
tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate (PubChem CID 102082026) has the molecular formula C26H36FNO6S2
and a molecular weight of 541.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate |
| PubChem CID | 102082026 |
| Molecular Formula | C26H36FNO6S2 |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate |
| SMILES | CCCCCCC[C@H](NC(=O)OC(C)(C)C)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H36FNO6S2/c1-5-6-7-8-15-20-23(28-24(29)34-25(2,3)4)26(27,35(30,31)21-16-11-9-12-17-21)36(32,33)22-18-13-10-14-19-22/h9-14,16-19,23H,5-8,15,20H2,1-4H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | QIGZRCGGKBTEKF-QHCPKHFHSA-N |
| XLogP | 5.81 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate (CID 102082026) is tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate is CCCCCCC[C@H](NC(=O)OC(C)(C)C)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate?
The InChIKey is QIGZRCGGKBTEKF-QHCPKHFHSA-N. The full InChI is InChI=1S/C26H36FNO6S2/c1-5-6-7-8-15-20-23(28-24(29)34-25(2,3)4)26(27,35(30,31)21-16-11-9-12-17-21)36(32,33)22-18-13-10-14-19-22/h9-14,16-19,23H,5-8,15,20H2,1-4H3,(H,28,29)/t23-/m0/s1.
What are the key properties of tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate?
tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate has a molecular weight of 541.71 g/mol, XLogP of 5.81, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorononan-2-yl]carbamate is sourced from PubChem (CID 102082026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).