C21H23BF2N2O — CID 102082107
2,2-difluoro-8-(2-methoxy-3-methylphenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 102082107) has the molecular formula C21H23BF2N2O and a molecular weight of 368.24 g/mol. Its IUPAC name is 2,2-difluoro-8-(2-methoxy-3-methylphenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(2-methoxy-3-methylphenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 102082107 |
| Molecular Formula | C21H23BF2N2O |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2,2-difluoro-8-(2-methoxy-3-methylphenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1c(C)cccc1C1=C2C(C)=CC(C)=[N+]2[B-](F)(F)n2c(C)cc(C)c21 |
| InChI | InChI=1S/C21H23BF2N2O/c1-12-8-7-9-17(21(12)27-6)18-19-13(2)10-15(4)25(19)22(23,24)26-16(5)11-14(3)20(18)26/h7-11H,1-6H3 |
| InChIKey | BNRYLCTZKVMAEO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|