C14H16O2 — CID 102082183
(R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-methoxyphenyl)methanol (PubChem CID 102082183) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-methoxyphenyl)methanol.
| Compound Name | (R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 102082183 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc([C@H](O)[C@@H]2C=CC=CC2)cc1 |
| InChI | InChI=1S/C14H16O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-5,7-11,14-15H,6H2,1H3/t11-,14-/m1/s1 |
| InChIKey | VWNABERIOVUGLK-BXUZGUMPSA-N |
| XLogP | 2.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |