C41H42N2O — CID 102082281
phenyl-bis[6-[(E)-6-phenylhex-3-enyl]-2-pyridinyl]methanol (PubChem CID 102082281) has the molecular formula C41H42N2O and a molecular weight of 578.80 g/mol. Its IUPAC name is phenyl-bis[6-[(E)-6-phenylhex-3-enyl]-2-pyridinyl]methanol.
| Compound Name | phenyl-bis[6-[(E)-6-phenylhex-3-enyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 102082281 |
| Molecular Formula | C41H42N2O |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | phenyl-bis[6-[(E)-6-phenylhex-3-enyl]-2-pyridinyl]methanol |
| SMILES | OC(c1ccccc1)(c1cccc(CC/C=C/CCc2ccccc2)n1)c1cccc(CC/C=C/CCc2ccccc2)n1 |
| InChI | InChI=1S/C41H42N2O/c44-41(36-26-14-7-15-27-36,39-32-18-30-37(42-39)28-16-3-1-8-20-34-22-10-5-11-23-34)40-33-19-31-38(43-40)29-17-4-2-9-21-35-24-12-6-13-25-35/h1-7,10-15,18-19,22-27,30-33,44H,8-9,16-17,20-21,28-29H2/b3-1+,4-2+ |
| InChIKey | UPBYGOBUEHHLGH-ZPUQHVIOSA-N |
| XLogP | 9.00 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|