C13H22OSi — CID 102082443
2,2-dimethyl-5-pent-4-enyl-3-prop-1-en-2-yl-5H-oxasilole (PubChem CID 102082443) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is 2,2-dimethyl-5-pent-4-enyl-3-prop-1-en-2-yl-5H-oxasilole.
| Compound Name | 2,2-dimethyl-5-pent-4-enyl-3-prop-1-en-2-yl-5H-oxasilole |
|---|---|
| PubChem CID | 102082443 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,2-dimethyl-5-pent-4-enyl-3-prop-1-en-2-yl-5H-oxasilole |
| SMILES | C=CCCCC1C=C(C(=C)C)[Si](C)(C)O1 |
| InChI | InChI=1S/C13H22OSi/c1-6-7-8-9-12-10-13(11(2)3)15(4,5)14-12/h6,10,12H,1-2,7-9H2,3-5H3 |
| InChIKey | VFOJBHVFDBZBGL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|