C26H27N3O2 — CID 102082728
5-benzamido-N-(2-phenylethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide (PubChem CID 102082728) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-benzamido-N-(2-phenylethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide.
| Compound Name | 5-benzamido-N-(2-phenylethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 102082728 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 5-benzamido-N-(2-phenylethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
| SMILES | O=C(NC1CCCN(C(=O)NCCc2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O2/c30-25(21-12-5-2-6-13-21)28-23-15-9-19-29(24-16-8-7-14-22(23)24)26(31)27-18-17-20-10-3-1-4-11-20/h1-8,10-14,16,23H,9,15,17-19H2,(H,27,31)(H,28,30) |
| InChIKey | PZGMTWIGHVPLDH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |