About tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate
tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate (PubChem CID 102082973) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate.
Molecular Properties
| Compound Name | tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate |
| PubChem CID | 102082973 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate |
| SMILES | CC(C)(C)CC(=O)/C=C/[C@](C#N)(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO3/c1-20(2,3)15-18(24)12-13-22(16-23,19(25)26-21(4,5)6)14-17-10-8-7-9-11-17/h7-13H,14-15H2,1-6H3/b13-12+/t22-/m1/s1 |
| InChIKey | OBYGWVZLMNHHFQ-CHHLAKQQSA-N |
| XLogP | 4.64 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate?
The IUPAC name of tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate (CID 102082973) is tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate.
What is the SMILES notation for tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate?
The canonical SMILES for tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate is CC(C)(C)CC(=O)/C=C/[C@](C#N)(Cc1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate?
The InChIKey is OBYGWVZLMNHHFQ-CHHLAKQQSA-N. The full InChI is InChI=1S/C22H29NO3/c1-20(2,3)15-18(24)12-13-22(16-23,19(25)26-21(4,5)6)14-17-10-8-7-9-11-17/h7-13H,14-15H2,1-6H3/b13-12+/t22-/m1/s1.
What are the key properties of tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate?
tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate has a molecular weight of 355.48 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E,2S)-2-benzyl-2-cyano-7,7-dimethyl-5-oxooct-3-enoate is sourced from PubChem (CID 102082973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).