C21H12F3N3O — CID 102083121
2-[4-(trifluoromethyl)phenyl]-1,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11,13,15-heptaen-17-one (PubChem CID 102083121) has the molecular formula C21H12F3N3O and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-1,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11,13,15-heptaen-17-one.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-1,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11,13,15-heptaen-17-one |
|---|---|
| PubChem CID | 102083121 |
| Molecular Formula | C21H12F3N3O |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-1,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11,13,15-heptaen-17-one |
| SMILES | O=C1c2ccccc2C2=Nc3ncccc3C(c3ccc(C(F)(F)F)cc3)N12 |
| InChI | InChI=1S/C21H12F3N3O/c22-21(23,24)13-9-7-12(8-10-13)17-16-6-3-11-25-18(16)26-19-14-4-1-2-5-15(14)20(28)27(17)19/h1-11,17H |
| InChIKey | UDHUGCBAPCSYIG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |