C16H16O4S — CID 102083136
(4S,4aR,8aS)-4-(benzenesulfinyl)-8a-methyl-1,4,4a,5-tetrahydroisochromene-3,6-dione (PubChem CID 102083136) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is (4S,4aR,8aS)-4-(benzenesulfinyl)-8a-methyl-1,4,4a,5-tetrahydroisochromene-3,6-dione.
| Compound Name | (4S,4aR,8aS)-4-(benzenesulfinyl)-8a-methyl-1,4,4a,5-tetrahydroisochromene-3,6-dione |
|---|---|
| PubChem CID | 102083136 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (4S,4aR,8aS)-4-(benzenesulfinyl)-8a-methyl-1,4,4a,5-tetrahydroisochromene-3,6-dione |
| SMILES | C[C@]12C=CC(=O)C[C@H]1[C@H](S(=O)c1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C16H16O4S/c1-16-8-7-11(17)9-13(16)14(15(18)20-10-16)21(19)12-5-3-2-4-6-12/h2-8,13-14H,9-10H2,1H3/t13-,14-,16+,21?/m0/s1 |
| InChIKey | BKPQAMULABDGHY-PSCNAMBASA-N |
| XLogP | 1.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |