C25H33NO2S — CID 102083215
4-methyl-N-[[(1R,4R)-4-methyl-5-phenylcyclohex-2-en-1-yl]methyl]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 102083215) has the molecular formula C25H33NO2S and a molecular weight of 411.61 g/mol. Its IUPAC name is 4-methyl-N-[[(1R,4R)-4-methyl-5-phenylcyclohex-2-en-1-yl]methyl]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(1R,4R)-4-methyl-5-phenylcyclohex-2-en-1-yl]methyl]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102083215 |
| Molecular Formula | C25H33NO2S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-methyl-N-[[(1R,4R)-4-methyl-5-phenylcyclohex-2-en-1-yl]methyl]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)C[C@H]2C=C[C@@H](C)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H33NO2S/c1-19(2)17-26(29(27,28)24-14-10-20(3)11-15-24)18-22-13-12-21(4)25(16-22)23-8-6-5-7-9-23/h5-15,19,21-22,25H,16-18H2,1-4H3/t21-,22+,25?/m1/s1 |
| InChIKey | KIPGOPIVPGGOFZ-RTIVMORXSA-N |
| XLogP | 5.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|