C28H41NO4Si — CID 102083279
(2R,5R)-5-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-methoxy-N,5-dimethyloxolane-2-carboxamide (PubChem CID 102083279) has the molecular formula C28H41NO4Si and a molecular weight of 483.73 g/mol. Its IUPAC name is (2R,5R)-5-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-methoxy-N,5-dimethyloxolane-2-carboxamide.
| Compound Name | (2R,5R)-5-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-methoxy-N,5-dimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 102083279 |
| Molecular Formula | C28H41NO4Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2R,5R)-5-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-N-methoxy-N,5-dimethyloxolane-2-carboxamide |
| SMILES | CON(C)C(=O)[C@H]1CC[C@](C)(C[C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H41NO4Si/c1-22(20-28(5)19-18-25(33-28)26(30)29(6)31-7)21-32-34(27(2,3)4,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,22,25H,18-21H2,1-7H3/t22-,25-,28-/m1/s1 |
| InChIKey | LGSVKWLDPPLFGH-WSOLHVCVSA-N |
| XLogP | 4.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|