C43H96Si7 — CID 102083549
ditert-butyl-methyl-[[(1S)-1,2,3-tris[ditert-butyl(methyl)silyl]-4,5-diethyltrisilol-1-yl]methyl]silane (PubChem CID 102083549) has the molecular formula C43H96Si7 and a molecular weight of 809.84 g/mol. Its IUPAC name is ditert-butyl-methyl-[[(1S)-1,2,3-tris[ditert-butyl(methyl)silyl]-4,5-diethyltrisilol-1-yl]methyl]silane.
| Compound Name | ditert-butyl-methyl-[[(1S)-1,2,3-tris[ditert-butyl(methyl)silyl]-4,5-diethyltrisilol-1-yl]methyl]silane |
|---|---|
| PubChem CID | 102083549 |
| Molecular Formula | C43H96Si7 |
| Molecular Weight | 809.84 g/mol |
| Exact Mass | 808.59 |
| IUPAC Name | ditert-butyl-methyl-[[(1S)-1,2,3-tris[ditert-butyl(methyl)silyl]-4,5-diethyltrisilol-1-yl]methyl]silane |
| SMILES | CCC1=C(CC)[Si@](C[Si](C)(C(C)(C)C)C(C)(C)C)([Si](C)(C(C)(C)C)C(C)(C)C)[Si]([Si](C)(C(C)(C)C)C(C)(C)C)=[Si]1[Si](C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C43H96Si7/c1-31-34-35(32-2)50(49(30,42(21,22)23)43(24,25)26,33-46(27,36(3,4)5)37(6,7)8)45(48(29,40(15,16)17)41(18,19)20)44(34)47(28,38(9,10)11)39(12,13)14/h31-33H2,1-30H3/t50-/m0/s1 |
| InChIKey | BUEFCOCAYPIRHW-DPDRHGIRSA-N |
| XLogP | 16.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.84 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|