C7H14S2 — CID 102083621
cis-(1R,2S)-cycloheptane-1,2-dithiol (PubChem CID 102083621) has the molecular formula C7H14S2 and a molecular weight of 162.32 g/mol. Its IUPAC name is cis-(1R,2S)-cycloheptane-1,2-dithiol.
| Compound Name | cis-(1R,2S)-cycloheptane-1,2-dithiol |
|---|---|
| PubChem CID | 102083621 |
| Molecular Formula | C7H14S2 |
| Molecular Weight | 162.32 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | cis-(1R,2S)-cycloheptane-1,2-dithiol |
| SMILES | S[C@@H]1CCCCC[C@@H]1S |
| InChI | InChI=1S/C7H14S2/c8-6-4-2-1-3-5-7(6)9/h6-9H,1-5H2/t6-,7+ |
| InChIKey | HSKXLONFPAHGJD-KNVOCYPGSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|