About 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one
2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one (PubChem CID 102083892) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one.
Molecular Properties
| Compound Name | 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one |
| PubChem CID | 102083892 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one |
| SMILES | O=C1N(c2ccccc2)CC2Cc3ccccc3N12 |
| InChI | InChI=1S/C16H14N2O/c19-16-17(13-7-2-1-3-8-13)11-14-10-12-6-4-5-9-15(12)18(14)16/h1-9,14H,10-11H2 |
| InChIKey | UGUHRAKUISTTPL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one?
The IUPAC name of 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one (CID 102083892) is 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one.
What is the SMILES notation for 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one?
The canonical SMILES for 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one is O=C1N(c2ccccc2)CC2Cc3ccccc3N12.
What is the InChIKey of 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one?
The InChIKey is UGUHRAKUISTTPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c19-16-17(13-7-2-1-3-8-13)11-14-10-12-6-4-5-9-15(12)18(14)16/h1-9,14H,10-11H2.
What are the key properties of 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one?
2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one has a molecular weight of 250.30 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-1-one is sourced from PubChem (CID 102083892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).