About (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one
(2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one (PubChem CID 102083959) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one.
Molecular Properties
| Compound Name | (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one |
| PubChem CID | 102083959 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one |
| SMILES | CCCC[C@]1(C)CC=C2C(=O)CCC=C2O1 |
| InChI | InChI=1S/C14H20O2/c1-3-4-9-14(2)10-8-11-12(15)6-5-7-13(11)16-14/h7-8H,3-6,9-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | UQCWCRMLDHEXGX-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one?
The IUPAC name of (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one (CID 102083959) is (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one.
What is the SMILES notation for (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one?
The canonical SMILES for (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one is CCCC[C@]1(C)CC=C2C(=O)CCC=C2O1.
What is the InChIKey of (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one?
The InChIKey is UQCWCRMLDHEXGX-CQSZACIVSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-4-9-14(2)10-8-11-12(15)6-5-7-13(11)16-14/h7-8H,3-6,9-10H2,1-2H3/t14-/m1/s1.
What are the key properties of (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one?
(2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one has a molecular weight of 220.31 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-butyl-2-methyl-6,7-dihydro-3H-chromen-5-one is sourced from PubChem (CID 102083959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).