C10H10F2N4 — CID 102084623
6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine-8-carbonitrile (PubChem CID 102084623) has the molecular formula C10H10F2N4 and a molecular weight of 224.21 g/mol. Its IUPAC name is 6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine-8-carbonitrile.
| Compound Name | 6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 102084623 |
| Molecular Formula | C10H10F2N4 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine-8-carbonitrile |
| SMILES | CN1CCN(C)c2c1nc(F)c(F)c2C#N |
| InChI | InChI=1S/C10H10F2N4/c1-15-3-4-16(2)10-8(15)6(5-13)7(11)9(12)14-10/h3-4H2,1-2H3 |
| InChIKey | JYCPEJJRVJEUHF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|