C12H10F9N3 — CID 102084628
6,7-difluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine (PubChem CID 102084628) has the molecular formula C12H10F9N3 and a molecular weight of 367.22 g/mol. Its IUPAC name is 6,7-difluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine.
| Compound Name | 6,7-difluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 102084628 |
| Molecular Formula | C12H10F9N3 |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 6,7-difluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazine |
| SMILES | CN1CCN(C)c2c1nc(F)c(F)c2C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F9N3/c1-23-3-4-24(2)9-7(23)5(6(13)8(14)22-9)10(15,11(16,17)18)12(19,20)21/h3-4H2,1-2H3 |
| InChIKey | SIZKZUNOOIOJNR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|