C16H18N2S3 — CID 102084789
8,11,14-trithia-20,21-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene (PubChem CID 102084789) has the molecular formula C16H18N2S3 and a molecular weight of 334.53 g/mol. Its IUPAC name is 8,11,14-trithia-20,21-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene.
| Compound Name | 8,11,14-trithia-20,21-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene |
|---|---|
| PubChem CID | 102084789 |
| Molecular Formula | C16H18N2S3 |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 8,11,14-trithia-20,21-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene |
| SMILES | c1cc2nc(c1)-c1cccc(n1)CSCCSCCSC2 |
| InChI | InChI=1S/C16H18N2S3/c1-3-13-11-20-9-7-19-8-10-21-12-14-4-2-6-16(18-14)15(5-1)17-13/h1-6H,7-12H2 |
| InChIKey | ZNORWXJPSIQPFF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |