C13H20OS — CID 102084879
(1R,6S,8S)-3,3,8-trimethyl-8-prop-1-en-2-yl-2-thiabicyclo[4.2.0]octan-5-one (PubChem CID 102084879) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is (1R,6S,8S)-3,3,8-trimethyl-8-prop-1-en-2-yl-2-thiabicyclo[4.2.0]octan-5-one.
| Compound Name | (1R,6S,8S)-3,3,8-trimethyl-8-prop-1-en-2-yl-2-thiabicyclo[4.2.0]octan-5-one |
|---|---|
| PubChem CID | 102084879 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (1R,6S,8S)-3,3,8-trimethyl-8-prop-1-en-2-yl-2-thiabicyclo[4.2.0]octan-5-one |
| SMILES | C=C(C)[C@]1(C)C[C@H]2C(=O)CC(C)(C)S[C@H]21 |
| InChI | InChI=1S/C13H20OS/c1-8(2)13(5)6-9-10(14)7-12(3,4)15-11(9)13/h9,11H,1,6-7H2,2-5H3/t9-,11+,13-/m0/s1 |
| InChIKey | BXMLZOMQXUHTFT-NDMJEZRESA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|