C24H27NO4S — CID 102085013
[(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 102085013) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102085013 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [(1R)-1-[(2R,3S)-2-methyl-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]prop-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#C[C@@H](OC(=O)C(C)(C)C)[C@@]1(C)[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO4S/c1-7-20(29-22(26)23(3,4)5)24(6)21(18-11-9-8-10-12-18)25(24)30(27,28)19-15-13-17(2)14-16-19/h1,8-16,20-21H,2-6H3/t20-,21+,24+,25?/m1/s1 |
| InChIKey | LUTSUEOVWPWILO-SNSIXXDBSA-N |
| XLogP | 4.09 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|