C27H33NO4S — CID 102085017
[(1R)-1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]-3-phenylprop-2-ynyl] acetate (PubChem CID 102085017) has the molecular formula C27H33NO4S and a molecular weight of 467.63 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]-3-phenylprop-2-ynyl] acetate.
| Compound Name | [(1R)-1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]-3-phenylprop-2-ynyl] acetate |
|---|---|
| PubChem CID | 102085017 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [(1R)-1-[(2R,3S)-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]-3-phenylprop-2-ynyl] acetate |
| SMILES | CC(=O)O[C@H](C#Cc1ccccc1)[C@@]1(C(C)C)[C@H](CC(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H33NO4S/c1-19(2)18-25-27(20(3)4,28(25)33(30,31)24-15-12-21(5)13-16-24)26(32-22(6)29)17-14-23-10-8-7-9-11-23/h7-13,15-16,19-20,25-26H,18H2,1-6H3/t25-,26+,27+,28?/m0/s1 |
| InChIKey | CFMVGEWWKVFQOF-JRVZRWKPSA-N |
| XLogP | 4.79 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|