C26H27Cl2NO3 — CID 102085031
[(1R)-1-[(2R,3S)-1-(4-chlorobenzoyl)-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate (PubChem CID 102085031) has the molecular formula C26H27Cl2NO3 and a molecular weight of 472.41 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S)-1-(4-chlorobenzoyl)-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate.
| Compound Name | [(1R)-1-[(2R,3S)-1-(4-chlorobenzoyl)-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 102085031 |
| Molecular Formula | C26H27Cl2NO3 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [(1R)-1-[(2R,3S)-1-(4-chlorobenzoyl)-3-(2-methylpropyl)-2-propan-2-ylaziridin-2-yl]prop-2-ynyl] 4-chlorobenzoate |
| SMILES | C#C[C@@H](OC(=O)c1ccc(Cl)cc1)[C@@]1(C(C)C)[C@H](CC(C)C)N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27Cl2NO3/c1-6-23(32-25(31)19-9-13-21(28)14-10-19)26(17(4)5)22(15-16(2)3)29(26)24(30)18-7-11-20(27)12-8-18/h1,7-14,16-17,22-23H,15H2,2-5H3/t22-,23+,26+,29?/m0/s1 |
| InChIKey | NABBNMRAZVNENE-IZJHKYFCSA-N |
| XLogP | 6.12 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|