C11H14O — CID 102085537
(1S,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 102085537) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (1S,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 102085537 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (1S,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1ccc2c(c1)[C@@H](O)[C@@H](C)C2 |
| InChI | InChI=1S/C11H14O/c1-7-3-4-9-6-8(2)11(12)10(9)5-7/h3-5,8,11-12H,6H2,1-2H3/t8-,11-/m0/s1 |
| InChIKey | ODZAJPZIKWGMCJ-KWQFWETISA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |