C28H29NO6S — CID 102085570
(4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 102085570) has the molecular formula C28H29NO6S and a molecular weight of 507.61 g/mol. Its IUPAC name is (4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102085570 |
| Molecular Formula | C28H29NO6S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (4R,5S)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)OC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H29NO6S/c1-3-25-27(35-28(30)29(25)36(31,32)24-16-14-21(2)15-17-24)26(34-19-23-12-8-5-9-13-23)20-33-18-22-10-6-4-7-11-22/h3-17,25-27H,1,18-20H2,2H3/t25-,26-,27+/m1/s1 |
| InChIKey | YYCUQYKAVUOKRJ-PFBJBMPXSA-N |
| XLogP | 4.86 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|