C51H36F6N2O2S2 — CID 102085950
4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methoxy-5-[4-(N-phenylanilino)phenyl]thiophen-3-yl]cyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-diphenylaniline (PubChem CID 102085950) has the molecular formula C51H36F6N2O2S2 and a molecular weight of 886.98 g/mol. Its IUPAC name is 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methoxy-5-[4-(N-phenylanilino)phenyl]thiophen-3-yl]cyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methoxy-5-[4-(N-phenylanilino)phenyl]thiophen-3-yl]cyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102085950 |
| Molecular Formula | C51H36F6N2O2S2 |
| Molecular Weight | 886.98 g/mol |
| Exact Mass | 886.21 |
| IUPAC Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methoxy-5-[4-(N-phenylanilino)phenyl]thiophen-3-yl]cyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-diphenylaniline |
| SMILES | COc1sc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1C1=C(c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc2OC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C51H36F6N2O2S2/c1-60-47-41(31-43(62-47)33-23-27-39(28-24-33)58(35-15-7-3-8-16-35)36-17-9-4-10-18-36)45-46(50(54,55)51(56,57)49(45,52)53)42-32-44(63-48(42)61-2)34-25-29-40(30-26-34)59(37-19-11-5-12-20-37)38-21-13-6-14-22-38/h3-32H,1-2H3 |
| InChIKey | GCCRNVRMSIGKOU-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.98 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|