About 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine
1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine (PubChem CID 102085980) has the molecular formula C6H8F11NOTe
and a molecular weight of 446.71 g/mol. Its IUPAC name is 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine |
| PubChem CID | 102085980 |
| Molecular Formula | C6H8F11NOTe |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine |
| SMILES | CN(C)CO[Te](F)(F)(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F11NOTe/c1-18(2)3-19-20(16,17,4(7,8)9,5(10,11)12)6(13,14)15/h3H2,1-2H3 |
| InChIKey | OHMICDTZQDRHSG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine?
The IUPAC name of 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine (CID 102085980) is 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine?
The canonical SMILES for 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine is CN(C)CO[Te](F)(F)(C(F)(F)F)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine?
The InChIKey is OHMICDTZQDRHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F11NOTe/c1-18(2)3-19-20(16,17,4(7,8)9,5(10,11)12)6(13,14)15/h3H2,1-2H3.
What are the key properties of 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine?
1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine has a molecular weight of 446.71 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[difluoro-tris(trifluoromethyl)-λ6-tellanyl]oxy-N,N-dimethylmethanamine is sourced from PubChem (CID 102085980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).