C20H23FO7 — CID 102086148
dimethyl (2S,3S,4S)-4-(2-ethoxy-2-oxoethyl)-2-(4-fluorophenyl)-3-formylcyclopentane-1,1-dicarboxylate (PubChem CID 102086148) has the molecular formula C20H23FO7 and a molecular weight of 394.40 g/mol. Its IUPAC name is dimethyl (2S,3S,4S)-4-(2-ethoxy-2-oxoethyl)-2-(4-fluorophenyl)-3-formylcyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (2S,3S,4S)-4-(2-ethoxy-2-oxoethyl)-2-(4-fluorophenyl)-3-formylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102086148 |
| Molecular Formula | C20H23FO7 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | dimethyl (2S,3S,4S)-4-(2-ethoxy-2-oxoethyl)-2-(4-fluorophenyl)-3-formylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C[C@@H]1CC(C(=O)OC)(C(=O)OC)[C@H](c2ccc(F)cc2)[C@H]1C=O |
| InChI | InChI=1S/C20H23FO7/c1-4-28-16(23)9-13-10-20(18(24)26-2,19(25)27-3)17(15(13)11-22)12-5-7-14(21)8-6-12/h5-8,11,13,15,17H,4,9-10H2,1-3H3/t13-,15+,17-/m1/s1 |
| InChIKey | SPHVLQIYEJGUFK-UKPHBRMFSA-N |
| XLogP | 2.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|